C10H15F3O2 — CID 103147013
6-methyl-1-(2,2,2-trifluoroethoxy)hept-6-en-3-one (PubChem CID 103147013) has the molecular formula C10H15F3O2 and a molecular weight of 224.22 g/mol. Its IUPAC name is 6-methyl-1-(2,2,2-trifluoroethoxy)hept-6-en-3-one.
| Compound Name | 6-methyl-1-(2,2,2-trifluoroethoxy)hept-6-en-3-one |
|---|---|
| PubChem CID | 103147013 |
| Molecular Formula | C10H15F3O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 6-methyl-1-(2,2,2-trifluoroethoxy)hept-6-en-3-one |
| SMILES | C=C(C)CCC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C10H15F3O2/c1-8(2)3-4-9(14)5-6-15-7-10(11,12)13/h1,3-7H2,2H3 |
| InChIKey | AEOKMMVMMMTAMN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|