C10H16F2O2 — CID 103147143
1-(2,2-difluoroethoxy)-5-methylideneheptan-3-one (PubChem CID 103147143) has the molecular formula C10H16F2O2 and a molecular weight of 206.23 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-5-methylideneheptan-3-one.
| Compound Name | 1-(2,2-difluoroethoxy)-5-methylideneheptan-3-one |
|---|---|
| PubChem CID | 103147143 |
| Molecular Formula | C10H16F2O2 |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-5-methylideneheptan-3-one |
| SMILES | C=C(CC)CC(=O)CCOCC(F)F |
| InChI | InChI=1S/C10H16F2O2/c1-3-8(2)6-9(13)4-5-14-7-10(11)12/h10H,2-7H2,1H3 |
| InChIKey | JZKCQSQHPJOCPG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|