C10H14F2O3 — CID 103147160
3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-5-yl)propan-1-one (PubChem CID 103147160) has the molecular formula C10H14F2O3 and a molecular weight of 220.21 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-5-yl)propan-1-one.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-5-yl)propan-1-one |
|---|---|
| PubChem CID | 103147160 |
| Molecular Formula | C10H14F2O3 |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-5-yl)propan-1-one |
| SMILES | O=C(CCOCC(F)F)C1=COCCC1 |
| InChI | InChI=1S/C10H14F2O3/c11-10(12)7-15-5-3-9(13)8-2-1-4-14-6-8/h6,10H,1-5,7H2 |
| InChIKey | IIDUSTJALOCEHH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|