C9H10F2N2O2 — CID 103147034
3-(2,2-difluoroethoxy)-1-pyrazin-2-ylpropan-1-one (PubChem CID 103147034) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-pyrazin-2-ylpropan-1-one.
| Compound Name | 3-(2,2-difluoroethoxy)-1-pyrazin-2-ylpropan-1-one |
|---|---|
| PubChem CID | 103147034 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-pyrazin-2-ylpropan-1-one |
| SMILES | O=C(CCOCC(F)F)c1cnccn1 |
| InChI | InChI=1S/C9H10F2N2O2/c10-9(11)6-15-4-1-8(14)7-5-12-2-3-13-7/h2-3,5,9H,1,4,6H2 |
| InChIKey | HLPADOQQTHMYFF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|