C13H16ClF4NO — CID 103148263
1-(3-chloro-2-fluorophenyl)-N-methyl-4-(2,2,2-trifluoroethoxy)butan-2-amine (PubChem CID 103148263) has the molecular formula C13H16ClF4NO and a molecular weight of 313.72 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-N-methyl-4-(2,2,2-trifluoroethoxy)butan-2-amine.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-N-methyl-4-(2,2,2-trifluoroethoxy)butan-2-amine |
|---|---|
| PubChem CID | 103148263 |
| Molecular Formula | C13H16ClF4NO |
| Molecular Weight | 313.72 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-N-methyl-4-(2,2,2-trifluoroethoxy)butan-2-amine |
| SMILES | CNC(CCOCC(F)(F)F)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C13H16ClF4NO/c1-19-10(5-6-20-8-13(16,17)18)7-9-3-2-4-11(14)12(9)15/h2-4,10,19H,5-8H2,1H3 |
| InChIKey | ATLFYCJTOPMEFC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.72 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|