C7H13F2NO — CID 103148870
5-(2,2-difluoroethoxy)pent-1-en-3-amine (PubChem CID 103148870) has the molecular formula C7H13F2NO and a molecular weight of 165.18 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)pent-1-en-3-amine.
| Compound Name | 5-(2,2-difluoroethoxy)pent-1-en-3-amine |
|---|---|
| PubChem CID | 103148870 |
| Molecular Formula | C7H13F2NO |
| Molecular Weight | 165.18 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 5-(2,2-difluoroethoxy)pent-1-en-3-amine |
| SMILES | C=CC(N)CCOCC(F)F |
| InChI | InChI=1S/C7H13F2NO/c1-2-6(10)3-4-11-5-7(8)9/h2,6-7H,1,3-5,10H2 |
| InChIKey | LXOQLCADUBJPHB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|