C7H14F2N2O — CID 103151808
5-(2,2-difluoroethoxy)pent-1-en-3-ylhydrazine (PubChem CID 103151808) has the molecular formula C7H14F2N2O and a molecular weight of 180.20 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)pent-1-en-3-ylhydrazine.
| Compound Name | 5-(2,2-difluoroethoxy)pent-1-en-3-ylhydrazine |
|---|---|
| PubChem CID | 103151808 |
| Molecular Formula | C7H14F2N2O |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 5-(2,2-difluoroethoxy)pent-1-en-3-ylhydrazine |
| SMILES | C=CC(CCOCC(F)F)NN |
| InChI | InChI=1S/C7H14F2N2O/c1-2-6(11-10)3-4-12-5-7(8)9/h2,6-7,11H,1,3-5,10H2 |
| InChIKey | YGHCUOWBIYKJDR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|