C13H21F2NOS — CID 103149430
4-(2,2-difluoroethoxy)-1-(5-ethylthiophen-2-yl)-N-methylbutan-2-amine (PubChem CID 103149430) has the molecular formula C13H21F2NOS and a molecular weight of 277.38 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-1-(5-ethylthiophen-2-yl)-N-methylbutan-2-amine.
| Compound Name | 4-(2,2-difluoroethoxy)-1-(5-ethylthiophen-2-yl)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 103149430 |
| Molecular Formula | C13H21F2NOS |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-1-(5-ethylthiophen-2-yl)-N-methylbutan-2-amine |
| SMILES | CCc1ccc(CC(CCOCC(F)F)NC)s1 |
| InChI | InChI=1S/C13H21F2NOS/c1-3-11-4-5-12(18-11)8-10(16-2)6-7-17-9-13(14)15/h4-5,10,13,16H,3,6-9H2,1-2H3 |
| InChIKey | AILLZCVMGJYUMI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|