C18H24O6 — CID 10314944
[(2R,3S)-3-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]oxiran-2-yl]methyl 2-methylpropanoate (PubChem CID 10314944) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is [(2R,3S)-3-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]oxiran-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2R,3S)-3-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]oxiran-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 10314944 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [(2R,3S)-3-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]oxiran-2-yl]methyl 2-methylpropanoate |
| SMILES | COc1cc([C@@H]2O[C@@H]2COC(=O)C(C)C)ccc1OC(=O)C(C)C |
| InChI | InChI=1S/C18H24O6/c1-10(2)17(19)22-9-15-16(23-15)12-6-7-13(14(8-12)21-5)24-18(20)11(3)4/h6-8,10-11,15-16H,9H2,1-5H3/t15-,16+/m1/s1 |
| InChIKey | QQRAASDQOIKUHO-CVEARBPZSA-N |
| XLogP | 2.90 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|