C12H25F2NO2 — CID 103149832
1-(2,2-difluoroethoxy)-6-methoxy-N-propylhexan-3-amine (PubChem CID 103149832) has the molecular formula C12H25F2NO2 and a molecular weight of 253.33 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-6-methoxy-N-propylhexan-3-amine.
| Compound Name | 1-(2,2-difluoroethoxy)-6-methoxy-N-propylhexan-3-amine |
|---|---|
| PubChem CID | 103149832 |
| Molecular Formula | C12H25F2NO2 |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-6-methoxy-N-propylhexan-3-amine |
| SMILES | CCCNC(CCCOC)CCOCC(F)F |
| InChI | InChI=1S/C12H25F2NO2/c1-3-7-15-11(5-4-8-16-2)6-9-17-10-12(13)14/h11-12,15H,3-10H2,1-2H3 |
| InChIKey | UVHZXAWVRNDFRF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|