C12H21F2NO — CID 103149853
1-(2,2-difluoroethoxy)-N-propylhept-5-yn-3-amine (PubChem CID 103149853) has the molecular formula C12H21F2NO and a molecular weight of 233.30 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-N-propylhept-5-yn-3-amine.
| Compound Name | 1-(2,2-difluoroethoxy)-N-propylhept-5-yn-3-amine |
|---|---|
| PubChem CID | 103149853 |
| Molecular Formula | C12H21F2NO |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-N-propylhept-5-yn-3-amine |
| SMILES | CC#CCC(CCOCC(F)F)NCCC |
| InChI | InChI=1S/C12H21F2NO/c1-3-5-6-11(15-8-4-2)7-9-16-10-12(13)14/h11-12,15H,4,6-10H2,1-2H3 |
| InChIKey | ZFHFUWFIJVNSCB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|