C11H18F2N2OS — CID 103150111
N-[[2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 103150111) has the molecular formula C11H18F2N2OS and a molecular weight of 264.34 g/mol. Its IUPAC name is N-[[2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 103150111 |
| Molecular Formula | C11H18F2N2OS |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-[[2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(CCOCC(F)F)s1 |
| InChI | InChI=1S/C11H18F2N2OS/c1-2-4-14-6-9-7-15-11(17-9)3-5-16-8-10(12)13/h7,10,14H,2-6,8H2,1H3 |
| InChIKey | WBTHGUDYJYHNKT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|