C11H13F3N2O4 — CID 103150197
ethyl 6-oxo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-5-carboxylate (PubChem CID 103150197) has the molecular formula C11H13F3N2O4 and a molecular weight of 294.23 g/mol. Its IUPAC name is ethyl 6-oxo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-oxo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 103150197 |
| Molecular Formula | C11H13F3N2O4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | ethyl 6-oxo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CCOCC(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C11H13F3N2O4/c1-2-20-10(18)7-5-15-8(16-9(7)17)3-4-19-6-11(12,13)14/h5H,2-4,6H2,1H3,(H,15,16,17) |
| InChIKey | PXRUKERVQDRZJN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|