C10H12F6N2OS — CID 103151283
1,1,1-trifluoro-2-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]propan-2-amine (PubChem CID 103151283) has the molecular formula C10H12F6N2OS and a molecular weight of 322.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]propan-2-amine.
| Compound Name | 1,1,1-trifluoro-2-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 103151283 |
| Molecular Formula | C10H12F6N2OS |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1,1,1-trifluoro-2-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]propan-2-amine |
| SMILES | CC(N)(c1csc(CCOCC(F)(F)F)n1)C(F)(F)F |
| InChI | InChI=1S/C10H12F6N2OS/c1-8(17,10(14,15)16)6-4-20-7(18-6)2-3-19-5-9(11,12)13/h4H,2-3,5,17H2,1H3 |
| InChIKey | ZJOWJXLOUQPCGL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|