C9H18F2N2O — CID 103151818
[1-cyclobutyl-3-(2,2-difluoroethoxy)propyl]hydrazine (PubChem CID 103151818) has the molecular formula C9H18F2N2O and a molecular weight of 208.25 g/mol. Its IUPAC name is [1-cyclobutyl-3-(2,2-difluoroethoxy)propyl]hydrazine.
| Compound Name | [1-cyclobutyl-3-(2,2-difluoroethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 103151818 |
| Molecular Formula | C9H18F2N2O |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | [1-cyclobutyl-3-(2,2-difluoroethoxy)propyl]hydrazine |
| SMILES | NNC(CCOCC(F)F)C1CCC1 |
| InChI | InChI=1S/C9H18F2N2O/c10-9(11)6-14-5-4-8(13-12)7-2-1-3-7/h7-9,13H,1-6,12H2 |
| InChIKey | WSQWVWCTQPZDGR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|