C8H16F2N2O — CID 103151872
[5-(2,2-difluoroethoxy)-2-methylpent-1-en-3-yl]hydrazine (PubChem CID 103151872) has the molecular formula C8H16F2N2O and a molecular weight of 194.22 g/mol. Its IUPAC name is [5-(2,2-difluoroethoxy)-2-methylpent-1-en-3-yl]hydrazine.
| Compound Name | [5-(2,2-difluoroethoxy)-2-methylpent-1-en-3-yl]hydrazine |
|---|---|
| PubChem CID | 103151872 |
| Molecular Formula | C8H16F2N2O |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | [5-(2,2-difluoroethoxy)-2-methylpent-1-en-3-yl]hydrazine |
| SMILES | C=C(C)C(CCOCC(F)F)NN |
| InChI | InChI=1S/C8H16F2N2O/c1-6(2)7(12-11)3-4-13-5-8(9)10/h7-8,12H,1,3-5,11H2,2H3 |
| InChIKey | ZBOXVJTYOWZQFJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|