C15H32F2N2O — CID 103151913
1-(2,2-difluoroethoxy)tridecan-3-ylhydrazine (PubChem CID 103151913) has the molecular formula C15H32F2N2O and a molecular weight of 294.43 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)tridecan-3-ylhydrazine.
| Compound Name | 1-(2,2-difluoroethoxy)tridecan-3-ylhydrazine |
|---|---|
| PubChem CID | 103151913 |
| Molecular Formula | C15H32F2N2O |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | 1-(2,2-difluoroethoxy)tridecan-3-ylhydrazine |
| SMILES | CCCCCCCCCCC(CCOCC(F)F)NN |
| InChI | InChI=1S/C15H32F2N2O/c1-2-3-4-5-6-7-8-9-10-14(19-18)11-12-20-13-15(16)17/h14-15,19H,2-13,18H2,1H3 |
| InChIKey | ARKQXVKZEWTTBF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|