C12H24F2N2O2 — CID 103152052
[1-(2,2-difluoroethoxy)-6-(oxolan-2-yl)hexan-3-yl]hydrazine (PubChem CID 103152052) has the molecular formula C12H24F2N2O2 and a molecular weight of 266.33 g/mol. Its IUPAC name is [1-(2,2-difluoroethoxy)-6-(oxolan-2-yl)hexan-3-yl]hydrazine.
| Compound Name | [1-(2,2-difluoroethoxy)-6-(oxolan-2-yl)hexan-3-yl]hydrazine |
|---|---|
| PubChem CID | 103152052 |
| Molecular Formula | C12H24F2N2O2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | [1-(2,2-difluoroethoxy)-6-(oxolan-2-yl)hexan-3-yl]hydrazine |
| SMILES | NNC(CCCC1CCCO1)CCOCC(F)F |
| InChI | InChI=1S/C12H24F2N2O2/c13-12(14)9-17-8-6-10(16-15)3-1-4-11-5-2-7-18-11/h10-12,16H,1-9,15H2 |
| InChIKey | FMWKXKHSCVOJOU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|