C21H28O4 — CID 10315486
4-[(9E)-heptadeca-1,9-dien-4,6-diyn-3-yl]oxy-4-oxobutanoic acid (PubChem CID 10315486) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 4-[(9E)-heptadeca-1,9-dien-4,6-diyn-3-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[(9E)-heptadeca-1,9-dien-4,6-diyn-3-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10315486 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 4-[(9E)-heptadeca-1,9-dien-4,6-diyn-3-yl]oxy-4-oxobutanoic acid |
| SMILES | C=CC(C#CC#CC/C=C/CCCCCCC)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C21H28O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-19(4-2)25-21(24)18-17-20(22)23/h4,10-11,19H,2-3,5-9,12,17-18H2,1H3,(H,22,23)/b11-10+ |
| InChIKey | MPVVNORSFOLHOJ-ZHACJKMWSA-N |
| XLogP | 4.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|