C41H72O4 — CID 176786113
4-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]oxy-4-oxobutanoic acid (PubChem CID 176786113) has the molecular formula C41H72O4 and a molecular weight of 629.02 g/mol. Its IUPAC name is 4-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 176786113 |
| Molecular Formula | C41H72O4 |
| Molecular Weight | 629.02 g/mol |
| Exact Mass | 628.54 |
| IUPAC Name | 4-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]oxy-4-oxobutanoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C41H72O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39(45-41(44)38-37-40(42)43)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,39H,3-10,15-16,21-38H2,1-2H3,(H,42,43)/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | FZSDAQWCNNLSSW-MAZCIEHSSA-N |
| XLogP | 13.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.02 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|