C11H18N4O4 — CID 103160509
3-methoxy-4-[5-(oxolan-2-ylmethyl)tetrazol-1-yl]butanoic acid (PubChem CID 103160509) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-methoxy-4-[5-(oxolan-2-ylmethyl)tetrazol-1-yl]butanoic acid.
| Compound Name | 3-methoxy-4-[5-(oxolan-2-ylmethyl)tetrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 103160509 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 3-methoxy-4-[5-(oxolan-2-ylmethyl)tetrazol-1-yl]butanoic acid |
| SMILES | COC(CC(=O)O)Cn1nnnc1CC1CCCO1 |
| InChI | InChI=1S/C11H18N4O4/c1-18-9(6-11(16)17)7-15-10(12-13-14-15)5-8-3-2-4-19-8/h8-9H,2-7H2,1H3,(H,16,17) |
| InChIKey | JUBSVEHRUVKIOZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |