C24H26N2O — CID 10316372
4-(2-methyl-1H-indol-3-yl)-1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one (PubChem CID 10316372) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-(2-methyl-1H-indol-3-yl)-1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one.
| Compound Name | 4-(2-methyl-1H-indol-3-yl)-1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 10316372 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 4-(2-methyl-1H-indol-3-yl)-1-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one |
| SMILES | Cc1[nH]c2ccccc2c1CCCC(=O)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N2O/c1-18-21(22-10-5-6-12-23(22)25-18)11-7-13-24(27)26-16-14-20(15-17-26)19-8-3-2-4-9-19/h2-6,8-10,12,14,25H,7,11,13,15-17H2,1H3 |
| InChIKey | IPNSJHWIAPTYIM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|