C17H36O4Si2 — CID 10316504
(E,5R)-7-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-5-trimethylsilyloxyhept-1-en-3-one (PubChem CID 10316504) has the molecular formula C17H36O4Si2 and a molecular weight of 360.64 g/mol. Its IUPAC name is (E,5R)-7-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-5-trimethylsilyloxyhept-1-en-3-one.
| Compound Name | (E,5R)-7-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-5-trimethylsilyloxyhept-1-en-3-one |
|---|---|
| PubChem CID | 10316504 |
| Molecular Formula | C17H36O4Si2 |
| Molecular Weight | 360.64 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | (E,5R)-7-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-5-trimethylsilyloxyhept-1-en-3-one |
| SMILES | CO/C=C/C(=O)C[C@@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H36O4Si2/c1-17(2,3)23(8,9)20-13-11-16(21-22(5,6)7)14-15(18)10-12-19-4/h10,12,16H,11,13-14H2,1-9H3/b12-10+/t16-/m1/s1 |
| InChIKey | XIQJWWOEAVCXSR-YBHKSSGVSA-N |
| XLogP | 4.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|