C14H26O3Si — CID 177419815
(2S)-2-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-2,3-dihydropyran-4-one (PubChem CID 177419815) has the molecular formula C14H26O3Si and a molecular weight of 270.44 g/mol. Its IUPAC name is (2S)-2-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-2,3-dihydropyran-4-one.
| Compound Name | (2S)-2-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 177419815 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (2S)-2-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-2,3-dihydropyran-4-one |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1CC(=O)C=CO1 |
| InChI | InChI=1S/C14H26O3Si/c1-11(13-9-12(15)7-8-16-13)10-17-18(5,6)14(2,3)4/h7-8,11,13H,9-10H2,1-6H3/t11-,13-/m0/s1 |
| InChIKey | QVLSXALKICBEGR-AAEUAGOBSA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|