C21H42O3Si2 — CID 11338505
(5S,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]nona-1,8-dien-3-one (PubChem CID 11338505) has the molecular formula C21H42O3Si2 and a molecular weight of 398.74 g/mol. Its IUPAC name is (5S,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]nona-1,8-dien-3-one.
| Compound Name | (5S,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]nona-1,8-dien-3-one |
|---|---|
| PubChem CID | 11338505 |
| Molecular Formula | C21H42O3Si2 |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (5S,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]nona-1,8-dien-3-one |
| SMILES | C=CC(=O)C[C@H](C[C@@H](C=C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O3Si2/c1-13-17(22)15-19(24-26(11,12)21(6,7)8)16-18(14-2)23-25(9,10)20(3,4)5/h13-14,18-19H,1-2,15-16H2,3-12H3/t18-,19-/m1/s1 |
| InChIKey | RRCDEMWTHLIYHJ-RTBURBONSA-N |
| XLogP | 6.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|