C17H13ClN2OS2 — CID 10316510
N-(3-chlorophenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide (PubChem CID 10316510) has the molecular formula C17H13ClN2OS2 and a molecular weight of 360.89 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 10316510 |
| Molecular Formula | C17H13ClN2OS2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N-(3-chlorophenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1sccc1SCc1ccncc1 |
| InChI | InChI=1S/C17H13ClN2OS2/c18-13-2-1-3-14(10-13)20-17(21)16-15(6-9-22-16)23-11-12-4-7-19-8-5-12/h1-10H,11H2,(H,20,21) |
| InChIKey | JPPBHAZCFBKTIG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |