C20H20N2O2S2 — CID 10068612
N-(4-propan-2-yloxyphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide (PubChem CID 10068612) has the molecular formula C20H20N2O2S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is N-(4-propan-2-yloxyphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide.
| Compound Name | N-(4-propan-2-yloxyphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 10068612 |
| Molecular Formula | C20H20N2O2S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-(4-propan-2-yloxyphenyl)-3-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide |
| SMILES | CC(C)Oc1ccc(NC(=O)c2sccc2SCc2ccncc2)cc1 |
| InChI | InChI=1S/C20H20N2O2S2/c1-14(2)24-17-5-3-16(4-6-17)22-20(23)19-18(9-12-25-19)26-13-15-7-10-21-11-8-15/h3-12,14H,13H2,1-2H3,(H,22,23) |
| InChIKey | QNMOMSNIBHBJLI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |