C15H15NO4S2 — CID 56782821
methyl 2-[4-[(3-methylsulfanylthiophene-2-carbonyl)amino]phenoxy]acetate (PubChem CID 56782821) has the molecular formula C15H15NO4S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 2-[4-[(3-methylsulfanylthiophene-2-carbonyl)amino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(3-methylsulfanylthiophene-2-carbonyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 56782821 |
| Molecular Formula | C15H15NO4S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | methyl 2-[4-[(3-methylsulfanylthiophene-2-carbonyl)amino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)c2sccc2SC)cc1 |
| InChI | InChI=1S/C15H15NO4S2/c1-19-13(17)9-20-11-5-3-10(4-6-11)16-15(18)14-12(21-2)7-8-22-14/h3-8H,9H2,1-2H3,(H,16,18) |
| InChIKey | CMMUVIZWQNDNOJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |