C17H19BrO — CID 103165718
1-(1-bromo-2-cyclobutylethyl)-4-methoxynaphthalene (PubChem CID 103165718) has the molecular formula C17H19BrO and a molecular weight of 319.24 g/mol. Its IUPAC name is 1-(1-bromo-2-cyclobutylethyl)-4-methoxynaphthalene.
| Compound Name | 1-(1-bromo-2-cyclobutylethyl)-4-methoxynaphthalene |
|---|---|
| PubChem CID | 103165718 |
| Molecular Formula | C17H19BrO |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-(1-bromo-2-cyclobutylethyl)-4-methoxynaphthalene |
| SMILES | COc1ccc(C(Br)CC2CCC2)c2ccccc12 |
| InChI | InChI=1S/C17H19BrO/c1-19-17-10-9-14(13-7-2-3-8-15(13)17)16(18)11-12-5-4-6-12/h2-3,7-10,12,16H,4-6,11H2,1H3 |
| InChIKey | OWLNMHUQAZQMGZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|