C18H21BrO2 — CID 65157917
2-[3-bromo-3-(4-methoxynaphthalen-1-yl)propyl]oxolane (PubChem CID 65157917) has the molecular formula C18H21BrO2 and a molecular weight of 349.27 g/mol. Its IUPAC name is 2-[3-bromo-3-(4-methoxynaphthalen-1-yl)propyl]oxolane.
| Compound Name | 2-[3-bromo-3-(4-methoxynaphthalen-1-yl)propyl]oxolane |
|---|---|
| PubChem CID | 65157917 |
| Molecular Formula | C18H21BrO2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-[3-bromo-3-(4-methoxynaphthalen-1-yl)propyl]oxolane |
| SMILES | COc1ccc(C(Br)CCC2CCCO2)c2ccccc12 |
| InChI | InChI=1S/C18H21BrO2/c1-20-18-11-9-15(14-6-2-3-7-16(14)18)17(19)10-8-13-5-4-12-21-13/h2-3,6-7,9,11,13,17H,4-5,8,10,12H2,1H3 |
| InChIKey | NRIBPKZEKYCDFI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|