C14H21ClOS — CID 103165987
2-[1-chloro-2-(3-ethoxycyclobutyl)ethyl]-3,5-dimethylthiophene (PubChem CID 103165987) has the molecular formula C14H21ClOS and a molecular weight of 272.84 g/mol. Its IUPAC name is 2-[1-chloro-2-(3-ethoxycyclobutyl)ethyl]-3,5-dimethylthiophene.
| Compound Name | 2-[1-chloro-2-(3-ethoxycyclobutyl)ethyl]-3,5-dimethylthiophene |
|---|---|
| PubChem CID | 103165987 |
| Molecular Formula | C14H21ClOS |
| Molecular Weight | 272.84 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-[1-chloro-2-(3-ethoxycyclobutyl)ethyl]-3,5-dimethylthiophene |
| SMILES | CCOC1CC(CC(Cl)c2sc(C)cc2C)C1 |
| InChI | InChI=1S/C14H21ClOS/c1-4-16-12-6-11(7-12)8-13(15)14-9(2)5-10(3)17-14/h5,11-13H,4,6-8H2,1-3H3 |
| InChIKey | RZFVGVFPKHVXSP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.84 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|