C21H19NO3S — CID 10316777
(E)-3-amino-2-(benzenesulfonyl)-1,3-diphenylprop-1-en-1-ol (PubChem CID 10316777) has the molecular formula C21H19NO3S and a molecular weight of 365.45 g/mol. Its IUPAC name is (E)-3-amino-2-(benzenesulfonyl)-1,3-diphenylprop-1-en-1-ol.
| Compound Name | (E)-3-amino-2-(benzenesulfonyl)-1,3-diphenylprop-1-en-1-ol |
|---|---|
| PubChem CID | 10316777 |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (E)-3-amino-2-(benzenesulfonyl)-1,3-diphenylprop-1-en-1-ol |
| SMILES | NC(/C(=C(\O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19NO3S/c22-19(16-10-4-1-5-11-16)21(20(23)17-12-6-2-7-13-17)26(24,25)18-14-8-3-9-15-18/h1-15,19,23H,22H2/b21-20+ |
| InChIKey | GPOLQKKKXHMFMA-QZQOTICOSA-N |
| XLogP | 4.09 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|