C19H32O5Si — CID 10316970
dimethyl 1-methyl-1-trimethylsilyl-2-oxadispiro[2.0.54.33]dodecane-11,11-dicarboxylate (PubChem CID 10316970) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is dimethyl 1-methyl-1-trimethylsilyl-2-oxadispiro[2.0.54.33]dodecane-11,11-dicarboxylate.
| Compound Name | dimethyl 1-methyl-1-trimethylsilyl-2-oxadispiro[2.0.54.33]dodecane-11,11-dicarboxylate |
|---|---|
| PubChem CID | 10316970 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | dimethyl 1-methyl-1-trimethylsilyl-2-oxadispiro[2.0.54.33]dodecane-11,11-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2(CCCCC2)C2(C1)OC2(C)[Si](C)(C)C |
| InChI | InChI=1S/C19H32O5Si/c1-16(25(4,5)6)19(24-16)13-18(14(20)22-2,15(21)23-3)12-17(19)10-8-7-9-11-17/h7-13H2,1-6H3 |
| InChIKey | QEKZPHCQKAOBMK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|