C23H42O4Si — CID 11177356
ethyl (1S,3aR,4R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-3a,7,7,7a-tetramethylspiro[3,4,5,6-tetrahydro-1H-indene-2,2'-oxirane]-1-carboxylate (PubChem CID 11177356) has the molecular formula C23H42O4Si and a molecular weight of 410.67 g/mol. Its IUPAC name is ethyl (1S,3aR,4R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-3a,7,7,7a-tetramethylspiro[3,4,5,6-tetrahydro-1H-indene-2,2'-oxirane]-1-carboxylate.
| Compound Name | ethyl (1S,3aR,4R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-3a,7,7,7a-tetramethylspiro[3,4,5,6-tetrahydro-1H-indene-2,2'-oxirane]-1-carboxylate |
|---|---|
| PubChem CID | 11177356 |
| Molecular Formula | C23H42O4Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | ethyl (1S,3aR,4R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-3a,7,7,7a-tetramethylspiro[3,4,5,6-tetrahydro-1H-indene-2,2'-oxirane]-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C2(CO2)C[C@@]2(C)[C@H](O[Si](C)(C)C(C)(C)C)CCC(C)(C)[C@@]12C |
| InChI | InChI=1S/C23H42O4Si/c1-11-25-18(24)17-22(8)20(5,6)13-12-16(27-28(9,10)19(2,3)4)21(22,7)14-23(17)15-26-23/h16-17H,11-15H2,1-10H3/t16-,17+,21+,22-,23?/m1/s1 |
| InChIKey | VXEILIYSDBXMFC-VGWHQLLNSA-N |
| XLogP | 5.56 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|