C20H38O4Si — CID 134945280
ethyl (3aR,5S,7R,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-7,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroindene-2-carboxylate (PubChem CID 134945280) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is ethyl (3aR,5S,7R,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-7,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroindene-2-carboxylate.
| Compound Name | ethyl (3aR,5S,7R,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-7,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroindene-2-carboxylate |
|---|---|
| PubChem CID | 134945280 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | ethyl (3aR,5S,7R,7aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-7,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroindene-2-carboxylate |
| SMILES | CCOC(=O)C1C[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](C)[C@]2(C)C1O |
| InChI | InChI=1S/C20H38O4Si/c1-9-23-18(22)16-12-14-11-15(24-25(7,8)19(3,4)5)10-13(2)20(14,6)17(16)21/h13-17,21H,9-12H2,1-8H3/t13-,14+,15+,16?,17?,20+/m1/s1 |
| InChIKey | BJOSAVHFXHIDRF-BGDAZGCLSA-N |
| XLogP | 4.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|