C19H34O5Si — CID 138980419
methyl (3aS,4S,7R,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-3-oxo-2,4,5,6,7,7a-hexahydro-1H-indene-3a-carboxylate (PubChem CID 138980419) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is methyl (3aS,4S,7R,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-3-oxo-2,4,5,6,7,7a-hexahydro-1H-indene-3a-carboxylate.
| Compound Name | methyl (3aS,4S,7R,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-3-oxo-2,4,5,6,7,7a-hexahydro-1H-indene-3a-carboxylate |
|---|---|
| PubChem CID | 138980419 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | methyl (3aS,4S,7R,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxy-3-oxo-2,4,5,6,7,7a-hexahydro-1H-indene-3a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)CC[C@@H]1[C@H](CO[Si](C)(C)C(C)(C)C)CC[C@@H]2OC |
| InChI | InChI=1S/C19H34O5Si/c1-18(2,3)25(6,7)24-12-13-8-11-16(22-4)19(17(21)23-5)14(13)9-10-15(19)20/h13-14,16H,8-12H2,1-7H3/t13-,14+,16-,19+/m0/s1 |
| InChIKey | OLQZBONQFRYQLR-QMYADUOMSA-N |
| XLogP | 3.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|