C19H36O4Si — CID 15678446
ethyl 3-butoxy-7a-trimethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylate (PubChem CID 15678446) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is ethyl 3-butoxy-7a-trimethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylate.
| Compound Name | ethyl 3-butoxy-7a-trimethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylate |
|---|---|
| PubChem CID | 15678446 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | ethyl 3-butoxy-7a-trimethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylate |
| SMILES | CCCCOC1CC(C(=O)OCC)C2(O[Si](C)(C)C)CCCCC12 |
| InChI | InChI=1S/C19H36O4Si/c1-6-8-13-22-17-14-16(18(20)21-7-2)19(23-24(3,4)5)12-10-9-11-15(17)19/h15-17H,6-14H2,1-5H3 |
| InChIKey | YSSNZEBFIGEYHM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|