C21H17F3N2O — CID 10317065
(2Z,4E)-2-benzoyl-5-(dimethylamino)-4-[3-(trifluoromethyl)phenyl]penta-2,4-dienenitrile (PubChem CID 10317065) has the molecular formula C21H17F3N2O and a molecular weight of 370.37 g/mol. Its IUPAC name is (2Z,4E)-2-benzoyl-5-(dimethylamino)-4-[3-(trifluoromethyl)phenyl]penta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-2-benzoyl-5-(dimethylamino)-4-[3-(trifluoromethyl)phenyl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 10317065 |
| Molecular Formula | C21H17F3N2O |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | (2Z,4E)-2-benzoyl-5-(dimethylamino)-4-[3-(trifluoromethyl)phenyl]penta-2,4-dienenitrile |
| SMILES | CN(C)/C=C(\C=C(\C#N)C(=O)c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17F3N2O/c1-26(2)14-18(16-9-6-10-19(12-16)21(22,23)24)11-17(13-25)20(27)15-7-4-3-5-8-15/h3-12,14H,1-2H3/b17-11-,18-14+ |
| InChIKey | YCRLZDQANLYRBB-DFCFSEMPSA-N |
| XLogP | 4.94 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|