C14H15BrN2O3S — CID 103174756
3-bromo-4-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]aniline (PubChem CID 103174756) has the molecular formula C14H15BrN2O3S and a molecular weight of 371.26 g/mol. Its IUPAC name is 3-bromo-4-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]aniline.
| Compound Name | 3-bromo-4-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]aniline |
|---|---|
| PubChem CID | 103174756 |
| Molecular Formula | C14H15BrN2O3S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 3-bromo-4-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]aniline |
| SMILES | COc1ccnc(CS(=O)c2ccc(N)cc2Br)c1OC |
| InChI | InChI=1S/C14H15BrN2O3S/c1-19-12-5-6-17-11(14(12)20-2)8-21(18)13-4-3-9(16)7-10(13)15/h3-7H,8,16H2,1-2H3 |
| InChIKey | HEYMZLNJARTYOW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|