C14H15BrN2O2S — CID 103173254
3-bromo-4-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]aniline (PubChem CID 103173254) has the molecular formula C14H15BrN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is 3-bromo-4-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]aniline.
| Compound Name | 3-bromo-4-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 103173254 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 3-bromo-4-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]aniline |
| SMILES | COc1ccnc(CSc2ccc(N)cc2Br)c1OC |
| InChI | InChI=1S/C14H15BrN2O2S/c1-18-12-5-6-17-11(14(12)19-2)8-20-13-4-3-9(16)7-10(13)15/h3-7H,8,16H2,1-2H3 |
| InChIKey | DJPNPLYKZXEBMB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|