2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid

C11H15NO5S — CID 103173703

IUPAC2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid
SMILESCOc1ccnc(CS(=O)C(C)C(=O)O)c1OC
InChIInChI=1S/C11H15NO5S/c1-7(11(13)14)18(15)6-8-10(17-3)9(16-2)4-5-12-8/h4-5,7H,6H2,1-3H3,(H,13,14)
InChIKeySESNYYPOFNAYEW-UHFFFAOYSA-N
MW273.31 g/mol
LogP0.82
Rot. Bonds6

About 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid

2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid (PubChem CID 103173703) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid.

Molecular Properties

Compound Name2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid
PubChem CID103173703
Molecular FormulaC11H15NO5S
Molecular Weight273.31 g/mol
Exact Mass273.07
IUPAC Name2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid
SMILESCOc1ccnc(CS(=O)C(C)C(=O)O)c1OC
InChIInChI=1S/C11H15NO5S/c1-7(11(13)14)18(15)6-8-10(17-3)9(16-2)4-5-12-8/h4-5,7H,6H2,1-3H3,(H,13,14)
InChIKeySESNYYPOFNAYEW-UHFFFAOYSA-N
XLogP0.82
TPSA85.72 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.31
LogP ≤ 50.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid?
The IUPAC name of 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid (CID 103173703) is 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid.
What is the SMILES notation for 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid?
The canonical SMILES for 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid is COc1ccnc(CS(=O)C(C)C(=O)O)c1OC.
What is the InChIKey of 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid?
The InChIKey is SESNYYPOFNAYEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO5S/c1-7(11(13)14)18(15)6-8-10(17-3)9(16-2)4-5-12-8/h4-5,7H,6H2,1-3H3,(H,13,14).
What are the key properties of 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid?
2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid has a molecular weight of 273.31 g/mol, XLogP of 0.82, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid is sourced from PubChem (CID 103173703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).