C11H15NO5S — CID 103173703
2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid (PubChem CID 103173703) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid.
| Compound Name | 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid |
|---|---|
| PubChem CID | 103173703 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]propanoic acid |
| SMILES | COc1ccnc(CS(=O)C(C)C(=O)O)c1OC |
| InChI | InChI=1S/C11H15NO5S/c1-7(11(13)14)18(15)6-8-10(17-3)9(16-2)4-5-12-8/h4-5,7H,6H2,1-3H3,(H,13,14) |
| InChIKey | SESNYYPOFNAYEW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |