C13H18N2O3S — CID 103176807
5-[2-(3-methoxypropoxy)ethoxy]-1,3-benzothiazol-4-amine (PubChem CID 103176807) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 5-[2-(3-methoxypropoxy)ethoxy]-1,3-benzothiazol-4-amine.
| Compound Name | 5-[2-(3-methoxypropoxy)ethoxy]-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 103176807 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 5-[2-(3-methoxypropoxy)ethoxy]-1,3-benzothiazol-4-amine |
| SMILES | COCCCOCCOc1ccc2scnc2c1N |
| InChI | InChI=1S/C13H18N2O3S/c1-16-5-2-6-17-7-8-18-10-3-4-11-13(12(10)14)15-9-19-11/h3-4,9H,2,5-8,14H2,1H3 |
| InChIKey | FYHLRKYNIORBQE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|