C14H17BrN2O3 — CID 103179363
3-bromo-8-[2-(3-methoxypropoxy)ethoxy]-1,5-naphthyridine (PubChem CID 103179363) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.20 g/mol. Its IUPAC name is 3-bromo-8-[2-(3-methoxypropoxy)ethoxy]-1,5-naphthyridine.
| Compound Name | 3-bromo-8-[2-(3-methoxypropoxy)ethoxy]-1,5-naphthyridine |
|---|---|
| PubChem CID | 103179363 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 3-bromo-8-[2-(3-methoxypropoxy)ethoxy]-1,5-naphthyridine |
| SMILES | COCCCOCCOc1ccnc2cc(Br)cnc12 |
| InChI | InChI=1S/C14H17BrN2O3/c1-18-5-2-6-19-7-8-20-13-3-4-16-12-9-11(15)10-17-14(12)13/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | DSJDJWRTYGKLBQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|