C11H5BrF6N2O — CID 102722622
3-bromo-8-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,5-naphthyridine (PubChem CID 102722622) has the molecular formula C11H5BrF6N2O and a molecular weight of 375.07 g/mol. Its IUPAC name is 3-bromo-8-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,5-naphthyridine.
| Compound Name | 3-bromo-8-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,5-naphthyridine |
|---|---|
| PubChem CID | 102722622 |
| Molecular Formula | C11H5BrF6N2O |
| Molecular Weight | 375.07 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 3-bromo-8-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,5-naphthyridine |
| SMILES | FC(F)(F)C(Oc1ccnc2cc(Br)cnc12)C(F)(F)F |
| InChI | InChI=1S/C11H5BrF6N2O/c12-5-3-6-8(20-4-5)7(1-2-19-6)21-9(10(13,14)15)11(16,17)18/h1-4,9H |
| InChIKey | OOSMGXSFKOXPHP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.07 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |