C12H17N3OS — CID 55141849
5-N-(3-methoxypropyl)-5-N-methyl-1,3-benzothiazole-4,5-diamine (PubChem CID 55141849) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 5-N-(3-methoxypropyl)-5-N-methyl-1,3-benzothiazole-4,5-diamine.
| Compound Name | 5-N-(3-methoxypropyl)-5-N-methyl-1,3-benzothiazole-4,5-diamine |
|---|---|
| PubChem CID | 55141849 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 5-N-(3-methoxypropyl)-5-N-methyl-1,3-benzothiazole-4,5-diamine |
| SMILES | COCCCN(C)c1ccc2scnc2c1N |
| InChI | InChI=1S/C12H17N3OS/c1-15(6-3-7-16-2)9-4-5-10-12(11(9)13)14-8-17-10/h4-5,8H,3,6-7,13H2,1-2H3 |
| InChIKey | MIQFVDPNUWDFRW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|