C14H29NO3 — CID 103177313
2-[2-(3-methoxypropoxy)ethoxy]-4,4-dimethylcyclohexan-1-amine (PubChem CID 103177313) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-[2-(3-methoxypropoxy)ethoxy]-4,4-dimethylcyclohexan-1-amine.
| Compound Name | 2-[2-(3-methoxypropoxy)ethoxy]-4,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 103177313 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 2-[2-(3-methoxypropoxy)ethoxy]-4,4-dimethylcyclohexan-1-amine |
| SMILES | COCCCOCCOC1CC(C)(C)CCC1N |
| InChI | InChI=1S/C14H29NO3/c1-14(2)6-5-12(15)13(11-14)18-10-9-17-8-4-7-16-3/h12-13H,4-11,15H2,1-3H3 |
| InChIKey | MAAVKEVBXYXMQT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|