C13H27NO — CID 81012391
[2-(3-methoxypropyl)-4,4-dimethylcyclohexyl]methanamine (PubChem CID 81012391) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is [2-(3-methoxypropyl)-4,4-dimethylcyclohexyl]methanamine.
| Compound Name | [2-(3-methoxypropyl)-4,4-dimethylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 81012391 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | [2-(3-methoxypropyl)-4,4-dimethylcyclohexyl]methanamine |
| SMILES | COCCCC1CC(C)(C)CCC1CN |
| InChI | InChI=1S/C13H27NO/c1-13(2)7-6-12(10-14)11(9-13)5-4-8-15-3/h11-12H,4-10,14H2,1-3H3 |
| InChIKey | NKQYYLCVJRSRHN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|