C24H39LiO2Si — CID 10318497
lithium (1R,2R,4R,11S)-4-[(2S)-1-[tert-butyl(dimethyl)silyl]oxyhex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-one (PubChem CID 10318497) has the molecular formula C24H39LiO2Si and a molecular weight of 394.60 g/mol. Its IUPAC name is lithium (1R,2R,4R,11S)-4-[(2S)-1-[tert-butyl(dimethyl)silyl]oxyhex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-one.
| Compound Name | lithium (1R,2R,4R,11S)-4-[(2S)-1-[tert-butyl(dimethyl)silyl]oxyhex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-one |
|---|---|
| PubChem CID | 10318497 |
| Molecular Formula | C24H39LiO2Si |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | lithium (1R,2R,4R,11S)-4-[(2S)-1-[tert-butyl(dimethyl)silyl]oxyhex-4-en-2-yl]-11-methyltricyclo[5.4.0.02,11]undec-7-en-3-one |
| SMILES | C/[C-]=C\C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1CCC2=CCC[C@]3(C)[C@H](C1=O)[C@H]23.[Li+] |
| InChI | InChI=1S/C24H39O2Si.Li/c1-8-9-11-18(16-26-27(6,7)23(2,3)4)19-14-13-17-12-10-15-24(5)20(17)21(24)22(19)25;/h9,12,18-21H,10-11,13-16H2,1-7H3;/q-1;+1/t18-,19-,20+,21+,24+;/m1./s1 |
| InChIKey | GSQTZDJJFVAXGO-WGFBSGGLSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|