C14H21N3O3 — CID 103185388
4-[(3,5-dimethyl-4-nitro-2-pyridinyl)methoxy]cyclohexan-1-amine (PubChem CID 103185388) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-4-nitro-2-pyridinyl)methoxy]cyclohexan-1-amine.
| Compound Name | 4-[(3,5-dimethyl-4-nitro-2-pyridinyl)methoxy]cyclohexan-1-amine |
|---|---|
| PubChem CID | 103185388 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 4-[(3,5-dimethyl-4-nitro-2-pyridinyl)methoxy]cyclohexan-1-amine |
| SMILES | Cc1cnc(COC2CCC(N)CC2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N3O3/c1-9-7-16-13(10(2)14(9)17(18)19)8-20-12-5-3-11(15)4-6-12/h7,11-12H,3-6,8,15H2,1-2H3 |
| InChIKey | UFKOYIDWUNRGCL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|