C14H13BrN2O3 — CID 103184379
2-[(4-bromophenoxy)methyl]-3,5-dimethyl-4-nitropyridine (PubChem CID 103184379) has the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. Its IUPAC name is 2-[(4-bromophenoxy)methyl]-3,5-dimethyl-4-nitropyridine.
| Compound Name | 2-[(4-bromophenoxy)methyl]-3,5-dimethyl-4-nitropyridine |
|---|---|
| PubChem CID | 103184379 |
| Molecular Formula | C14H13BrN2O3 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 2-[(4-bromophenoxy)methyl]-3,5-dimethyl-4-nitropyridine |
| SMILES | Cc1cnc(COc2ccc(Br)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13BrN2O3/c1-9-7-16-13(10(2)14(9)17(18)19)8-20-12-5-3-11(15)4-6-12/h3-7H,8H2,1-2H3 |
| InChIKey | YAELHPGEJFGZMO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|